About 6-methyl-2-oxo-N-[(1S,3S)-3-(trifluoromethyl)cyclohexyl]-1H-pyridine-3-carboxamide
6-methyl-2-oxo-N-[(1S,3S)-3-(trifluoromethyl)cyclohexyl]-1H-pyridine-3-carboxamide (PubChem CID 95976377) has the molecular formula C14H17F3N2O2
and a molecular weight of 302.30 g/mol. Its IUPAC name is 6-methyl-2-oxo-N-[(1S,3S)-3-(trifluoromethyl)cyclohexyl]-1H-pyridine-3-carboxamide.
Molecular Properties
| Compound Name | 6-methyl-2-oxo-N-[(1S,3S)-3-(trifluoromethyl)cyclohexyl]-1H-pyridine-3-carboxamide |
| PubChem CID | 95976377 |
| Molecular Formula | C14H17F3N2O2 |
| Molecular Weight | 302.30 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | 6-methyl-2-oxo-N-[(1S,3S)-3-(trifluoromethyl)cyclohexyl]-1H-pyridine-3-carboxamide |
| SMILES | Cc1ccc(C(=O)N[C@H]2CCC[C@H](C(F)(F)F)C2)c(=O)[nH]1 |
| InChI | InChI=1S/C14H17F3N2O2/c1-8-5-6-11(12(20)18-8)13(21)19-10-4-2-3-9(7-10)14(15,16)17/h5-6,9-10H,2-4,7H2,1H3,(H,18,20)(H,19,21)/t9-,10-/m0/s1 |
| InChIKey | FQAWIFKAFJMSFY-UWVGGRQHSA-N |
| XLogP | 2.53 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.30 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-methyl-2-oxo-N-[(1S,3S)-3-(trifluoromethyl)cyclohexyl]-1H-pyridine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-2-oxo-N-[(1S,3S)-3-(trifluoromethyl)cyclohexyl]-1H-pyridine-3-carboxamide?
The IUPAC name of 6-methyl-2-oxo-N-[(1S,3S)-3-(trifluoromethyl)cyclohexyl]-1H-pyridine-3-carboxamide (CID 95976377) is 6-methyl-2-oxo-N-[(1S,3S)-3-(trifluoromethyl)cyclohexyl]-1H-pyridine-3-carboxamide.
What is the SMILES notation for 6-methyl-2-oxo-N-[(1S,3S)-3-(trifluoromethyl)cyclohexyl]-1H-pyridine-3-carboxamide?
The canonical SMILES for 6-methyl-2-oxo-N-[(1S,3S)-3-(trifluoromethyl)cyclohexyl]-1H-pyridine-3-carboxamide is Cc1ccc(C(=O)N[C@H]2CCC[C@H](C(F)(F)F)C2)c(=O)[nH]1.
What is the InChIKey of 6-methyl-2-oxo-N-[(1S,3S)-3-(trifluoromethyl)cyclohexyl]-1H-pyridine-3-carboxamide?
The InChIKey is FQAWIFKAFJMSFY-UWVGGRQHSA-N. The full InChI is InChI=1S/C14H17F3N2O2/c1-8-5-6-11(12(20)18-8)13(21)19-10-4-2-3-9(7-10)14(15,16)17/h5-6,9-10H,2-4,7H2,1H3,(H,18,20)(H,19,21)/t9-,10-/m0/s1.
What are the key properties of 6-methyl-2-oxo-N-[(1S,3S)-3-(trifluoromethyl)cyclohexyl]-1H-pyridine-3-carboxamide?
6-methyl-2-oxo-N-[(1S,3S)-3-(trifluoromethyl)cyclohexyl]-1H-pyridine-3-carboxamide has a molecular weight of 302.30 g/mol, XLogP of 2.53, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-2-oxo-N-[(1S,3S)-3-(trifluoromethyl)cyclohexyl]-1H-pyridine-3-carboxamide is sourced from PubChem (CID 95976377), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).