C18H20FN3O — CID 95977808
1-[(R)-cyclobutyl-(4-fluorophenyl)methyl]-3-(pyridin-4-ylmethyl)urea (PubChem CID 95977808) has the molecular formula C18H20FN3O and a molecular weight of 313.38 g/mol. Its IUPAC name is 1-[(R)-cyclobutyl-(4-fluorophenyl)methyl]-3-(pyridin-4-ylmethyl)urea.
| Compound Name | 1-[(R)-cyclobutyl-(4-fluorophenyl)methyl]-3-(pyridin-4-ylmethyl)urea |
|---|---|
| PubChem CID | 95977808 |
| Molecular Formula | C18H20FN3O |
| Molecular Weight | 313.38 g/mol |
| Exact Mass | 313.16 |
| IUPAC Name | 1-[(R)-cyclobutyl-(4-fluorophenyl)methyl]-3-(pyridin-4-ylmethyl)urea |
| SMILES | O=C(NCc1ccncc1)N[C@@H](c1ccc(F)cc1)C1CCC1 |
| InChI | InChI=1S/C18H20FN3O/c19-16-6-4-15(5-7-16)17(14-2-1-3-14)22-18(23)21-12-13-8-10-20-11-9-13/h4-11,14,17H,1-3,12H2,(H2,21,22,23)/t17-/m1/s1 |
| InChIKey | IKKZCJQLSMMOIO-QGZVFWFLSA-N |
| XLogP | 3.56 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.38 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |