C15H16FN3O4 — CID 95977922
(2S)-2-(3,5-dimethyl-1,2-oxazol-4-yl)-N-(4-fluoro-2-nitrophenyl)butanamide (PubChem CID 95977922) has the molecular formula C15H16FN3O4 and a molecular weight of 321.31 g/mol. Its IUPAC name is (2S)-2-(3,5-dimethyl-1,2-oxazol-4-yl)-N-(4-fluoro-2-nitrophenyl)butanamide.
| Compound Name | (2S)-2-(3,5-dimethyl-1,2-oxazol-4-yl)-N-(4-fluoro-2-nitrophenyl)butanamide |
|---|---|
| PubChem CID | 95977922 |
| Molecular Formula | C15H16FN3O4 |
| Molecular Weight | 321.31 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | (2S)-2-(3,5-dimethyl-1,2-oxazol-4-yl)-N-(4-fluoro-2-nitrophenyl)butanamide |
| SMILES | CC[C@H](C(=O)Nc1ccc(F)cc1[N+](=O)[O-])c1c(C)noc1C |
| InChI | InChI=1S/C15H16FN3O4/c1-4-11(14-8(2)18-23-9(14)3)15(20)17-12-6-5-10(16)7-13(12)19(21)22/h5-7,11H,4H2,1-3H3,(H,17,20)/t11-/m0/s1 |
| InChIKey | NCDSWDMQDJBNAK-NSHDSACASA-N |
| XLogP | 3.47 |
| TPSA | 98.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.31 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|