C15H24F3N3O — CID 95978821
(2R)-2-[(3,5-dimethylpyrazol-1-yl)methyl]-1-[2-(2,2,2-trifluoroethoxy)ethyl]piperidine (PubChem CID 95978821) has the molecular formula C15H24F3N3O and a molecular weight of 319.37 g/mol. Its IUPAC name is (2R)-2-[(3,5-dimethylpyrazol-1-yl)methyl]-1-[2-(2,2,2-trifluoroethoxy)ethyl]piperidine.
| Compound Name | (2R)-2-[(3,5-dimethylpyrazol-1-yl)methyl]-1-[2-(2,2,2-trifluoroethoxy)ethyl]piperidine |
|---|---|
| PubChem CID | 95978821 |
| Molecular Formula | C15H24F3N3O |
| Molecular Weight | 319.37 g/mol |
| Exact Mass | 319.19 |
| IUPAC Name | (2R)-2-[(3,5-dimethylpyrazol-1-yl)methyl]-1-[2-(2,2,2-trifluoroethoxy)ethyl]piperidine |
| SMILES | Cc1cc(C)n(C[C@H]2CCCCN2CCOCC(F)(F)F)n1 |
| InChI | InChI=1S/C15H24F3N3O/c1-12-9-13(2)21(19-12)10-14-5-3-4-6-20(14)7-8-22-11-15(16,17)18/h9,14H,3-8,10-11H2,1-2H3/t14-/m1/s1 |
| InChIKey | MUPZNKDYLPLMQU-CQSZACIVSA-N |
| XLogP | 2.93 |
| TPSA | 30.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.37 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|