C12H20N4O — CID 95978876
(2S)-4-(3-methylbut-2-enyl)-2-(1,2,4-triazol-1-ylmethyl)morpholine (PubChem CID 95978876) has the molecular formula C12H20N4O and a molecular weight of 236.32 g/mol. Its IUPAC name is (2S)-4-(3-methylbut-2-enyl)-2-(1,2,4-triazol-1-ylmethyl)morpholine.
| Compound Name | (2S)-4-(3-methylbut-2-enyl)-2-(1,2,4-triazol-1-ylmethyl)morpholine |
|---|---|
| PubChem CID | 95978876 |
| Molecular Formula | C12H20N4O |
| Molecular Weight | 236.32 g/mol |
| Exact Mass | 236.16 |
| IUPAC Name | (2S)-4-(3-methylbut-2-enyl)-2-(1,2,4-triazol-1-ylmethyl)morpholine |
| SMILES | CC(C)=CCN1CCO[C@H](Cn2cncn2)C1 |
| InChI | InChI=1S/C12H20N4O/c1-11(2)3-4-15-5-6-17-12(7-15)8-16-10-13-9-14-16/h3,9-10,12H,4-8H2,1-2H3/t12-/m0/s1 |
| InChIKey | KKUPEIWZXIRVGE-LBPRGKRZSA-N |
| XLogP | 0.95 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.32 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|