C11H18F3N3O — CID 95979396
(2R,3S)-3-pyrazol-1-yl-N-[2-(2,2,2-trifluoroethoxy)ethyl]butan-2-amine (PubChem CID 95979396) has the molecular formula C11H18F3N3O and a molecular weight of 265.28 g/mol. Its IUPAC name is (2R,3S)-3-pyrazol-1-yl-N-[2-(2,2,2-trifluoroethoxy)ethyl]butan-2-amine.
| Compound Name | (2R,3S)-3-pyrazol-1-yl-N-[2-(2,2,2-trifluoroethoxy)ethyl]butan-2-amine |
|---|---|
| PubChem CID | 95979396 |
| Molecular Formula | C11H18F3N3O |
| Molecular Weight | 265.28 g/mol |
| Exact Mass | 265.14 |
| IUPAC Name | (2R,3S)-3-pyrazol-1-yl-N-[2-(2,2,2-trifluoroethoxy)ethyl]butan-2-amine |
| SMILES | C[C@@H](NCCOCC(F)(F)F)[C@H](C)n1cccn1 |
| InChI | InChI=1S/C11H18F3N3O/c1-9(10(2)17-6-3-4-16-17)15-5-7-18-8-11(12,13)14/h3-4,6,9-10,15H,5,7-8H2,1-2H3/t9-,10+/m1/s1 |
| InChIKey | UPWHMMXHFJZPEH-ZJUUUORDSA-N |
| XLogP | 2.00 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.28 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|