C16H22N4O — CID 95980716
(2S)-N-(2-anilinoethyl)-2-(3,5-dimethylpyrazol-1-yl)propanamide (PubChem CID 95980716) has the molecular formula C16H22N4O and a molecular weight of 286.38 g/mol. Its IUPAC name is (2S)-N-(2-anilinoethyl)-2-(3,5-dimethylpyrazol-1-yl)propanamide.
| Compound Name | (2S)-N-(2-anilinoethyl)-2-(3,5-dimethylpyrazol-1-yl)propanamide |
|---|---|
| PubChem CID | 95980716 |
| Molecular Formula | C16H22N4O |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.18 |
| IUPAC Name | (2S)-N-(2-anilinoethyl)-2-(3,5-dimethylpyrazol-1-yl)propanamide |
| SMILES | Cc1cc(C)n([C@@H](C)C(=O)NCCNc2ccccc2)n1 |
| InChI | InChI=1S/C16H22N4O/c1-12-11-13(2)20(19-12)14(3)16(21)18-10-9-17-15-7-5-4-6-8-15/h4-8,11,14,17H,9-10H2,1-3H3,(H,18,21)/t14-/m0/s1 |
| InChIKey | KQMVOFQQEIMPRZ-AWEZNQCLSA-N |
| XLogP | 2.29 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|