C15H23NO4S2 — CID 95981451
(2R,4S)-1-[2,4-bis(methylsulfonyl)phenyl]-2,4-dimethylpiperidine (PubChem CID 95981451) has the molecular formula C15H23NO4S2 and a molecular weight of 345.49 g/mol. Its IUPAC name is (2R,4S)-1-[2,4-bis(methylsulfonyl)phenyl]-2,4-dimethylpiperidine.
| Compound Name | (2R,4S)-1-[2,4-bis(methylsulfonyl)phenyl]-2,4-dimethylpiperidine |
|---|---|
| PubChem CID | 95981451 |
| Molecular Formula | C15H23NO4S2 |
| Molecular Weight | 345.49 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | (2R,4S)-1-[2,4-bis(methylsulfonyl)phenyl]-2,4-dimethylpiperidine |
| SMILES | C[C@H]1CCN(c2ccc(S(C)(=O)=O)cc2S(C)(=O)=O)[C@H](C)C1 |
| InChI | InChI=1S/C15H23NO4S2/c1-11-7-8-16(12(2)9-11)14-6-5-13(21(3,17)18)10-15(14)22(4,19)20/h5-6,10-12H,7-9H2,1-4H3/t11-,12+/m0/s1 |
| InChIKey | NBWKKBQJFANSHZ-NWDGAFQWSA-N |
| XLogP | 2.12 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.49 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |