C15H17NO2S2 — CID 95982653
N-[(2R)-2-hydroxy-2-(3-methylthiophen-2-yl)ethyl]-2-methylsulfanylbenzamide (PubChem CID 95982653) has the molecular formula C15H17NO2S2 and a molecular weight of 307.44 g/mol. Its IUPAC name is N-[(2R)-2-hydroxy-2-(3-methylthiophen-2-yl)ethyl]-2-methylsulfanylbenzamide.
| Compound Name | N-[(2R)-2-hydroxy-2-(3-methylthiophen-2-yl)ethyl]-2-methylsulfanylbenzamide |
|---|---|
| PubChem CID | 95982653 |
| Molecular Formula | C15H17NO2S2 |
| Molecular Weight | 307.44 g/mol |
| Exact Mass | 307.07 |
| IUPAC Name | N-[(2R)-2-hydroxy-2-(3-methylthiophen-2-yl)ethyl]-2-methylsulfanylbenzamide |
| SMILES | CSc1ccccc1C(=O)NC[C@@H](O)c1sccc1C |
| InChI | InChI=1S/C15H17NO2S2/c1-10-7-8-20-14(10)12(17)9-16-15(18)11-5-3-4-6-13(11)19-2/h3-8,12,17H,9H2,1-2H3,(H,16,18)/t12-/m1/s1 |
| InChIKey | LWCBXIMVPYILPY-GFCCVEGCSA-N |
| XLogP | 3.24 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.44 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |