C12H15ClFNO3S — CID 95984028
3-chloro-4-fluoro-N-[(1S,3R)-3-hydroxycyclohexyl]benzenesulfonamide (PubChem CID 95984028) has the molecular formula C12H15ClFNO3S and a molecular weight of 307.77 g/mol. Its IUPAC name is 3-chloro-4-fluoro-N-[(1S,3R)-3-hydroxycyclohexyl]benzenesulfonamide.
| Compound Name | 3-chloro-4-fluoro-N-[(1S,3R)-3-hydroxycyclohexyl]benzenesulfonamide |
|---|---|
| PubChem CID | 95984028 |
| Molecular Formula | C12H15ClFNO3S |
| Molecular Weight | 307.77 g/mol |
| Exact Mass | 307.04 |
| IUPAC Name | 3-chloro-4-fluoro-N-[(1S,3R)-3-hydroxycyclohexyl]benzenesulfonamide |
| SMILES | O=S(=O)(N[C@H]1CCC[C@@H](O)C1)c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C12H15ClFNO3S/c13-11-7-10(4-5-12(11)14)19(17,18)15-8-2-1-3-9(16)6-8/h4-5,7-9,15-16H,1-3,6H2/t8-,9+/m0/s1 |
| InChIKey | DKUOKMIHBSOLLL-DTWKUNHWSA-N |
| XLogP | 2.06 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.77 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |