C13H26N2O2S — CID 95984540
1-cyclohexyl-3-[(2R)-2-hydroxy-2-methyl-4-methylsulfanylbutyl]urea (PubChem CID 95984540) has the molecular formula C13H26N2O2S and a molecular weight of 274.43 g/mol. Its IUPAC name is 1-cyclohexyl-3-[(2R)-2-hydroxy-2-methyl-4-methylsulfanylbutyl]urea.
| Compound Name | 1-cyclohexyl-3-[(2R)-2-hydroxy-2-methyl-4-methylsulfanylbutyl]urea |
|---|---|
| PubChem CID | 95984540 |
| Molecular Formula | C13H26N2O2S |
| Molecular Weight | 274.43 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | 1-cyclohexyl-3-[(2R)-2-hydroxy-2-methyl-4-methylsulfanylbutyl]urea |
| SMILES | CSCC[C@@](C)(O)CNC(=O)NC1CCCCC1 |
| InChI | InChI=1S/C13H26N2O2S/c1-13(17,8-9-18-2)10-14-12(16)15-11-6-4-3-5-7-11/h11,17H,3-10H2,1-2H3,(H2,14,15,16)/t13-/m1/s1 |
| InChIKey | KZHPVSIZGJFSFQ-CYBMUJFWSA-N |
| XLogP | 2.12 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.43 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |