About N-[(3S)-3-hydroxy-4,4-dimethylpentyl]-2-thiophen-2-ylacetamide
N-[(3S)-3-hydroxy-4,4-dimethylpentyl]-2-thiophen-2-ylacetamide (PubChem CID 95984593) has the molecular formula C13H21NO2S
and a molecular weight of 255.38 g/mol. Its IUPAC name is N-[(3S)-3-hydroxy-4,4-dimethylpentyl]-2-thiophen-2-ylacetamide.
Molecular Properties
| Compound Name | N-[(3S)-3-hydroxy-4,4-dimethylpentyl]-2-thiophen-2-ylacetamide |
| PubChem CID | 95984593 |
| Molecular Formula | C13H21NO2S |
| Molecular Weight | 255.38 g/mol |
| Exact Mass | 255.13 |
| IUPAC Name | N-[(3S)-3-hydroxy-4,4-dimethylpentyl]-2-thiophen-2-ylacetamide |
| SMILES | CC(C)(C)[C@@H](O)CCNC(=O)Cc1cccs1 |
| InChI | InChI=1S/C13H21NO2S/c1-13(2,3)11(15)6-7-14-12(16)9-10-5-4-8-17-10/h4-5,8,11,15H,6-7,9H2,1-3H3,(H,14,16)/t11-/m0/s1 |
| InChIKey | JTAWICBRIDVXFL-NSHDSACASA-N |
| XLogP | 2.20 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.38 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(3S)-3-hydroxy-4,4-dimethylpentyl]-2-thiophen-2-ylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3S)-3-hydroxy-4,4-dimethylpentyl]-2-thiophen-2-ylacetamide?
The IUPAC name of N-[(3S)-3-hydroxy-4,4-dimethylpentyl]-2-thiophen-2-ylacetamide (CID 95984593) is N-[(3S)-3-hydroxy-4,4-dimethylpentyl]-2-thiophen-2-ylacetamide.
What is the SMILES notation for N-[(3S)-3-hydroxy-4,4-dimethylpentyl]-2-thiophen-2-ylacetamide?
The canonical SMILES for N-[(3S)-3-hydroxy-4,4-dimethylpentyl]-2-thiophen-2-ylacetamide is CC(C)(C)[C@@H](O)CCNC(=O)Cc1cccs1.
What is the InChIKey of N-[(3S)-3-hydroxy-4,4-dimethylpentyl]-2-thiophen-2-ylacetamide?
The InChIKey is JTAWICBRIDVXFL-NSHDSACASA-N. The full InChI is InChI=1S/C13H21NO2S/c1-13(2,3)11(15)6-7-14-12(16)9-10-5-4-8-17-10/h4-5,8,11,15H,6-7,9H2,1-3H3,(H,14,16)/t11-/m0/s1.
What are the key properties of N-[(3S)-3-hydroxy-4,4-dimethylpentyl]-2-thiophen-2-ylacetamide?
N-[(3S)-3-hydroxy-4,4-dimethylpentyl]-2-thiophen-2-ylacetamide has a molecular weight of 255.38 g/mol, XLogP of 2.20, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3S)-3-hydroxy-4,4-dimethylpentyl]-2-thiophen-2-ylacetamide is sourced from PubChem (CID 95984593), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).