C17H21NO3 — CID 95984877
(1R)-N-[[(4R)-4-hydroxy-2,3-dihydrochromen-4-yl]methyl]cyclohex-3-ene-1-carboxamide (PubChem CID 95984877) has the molecular formula C17H21NO3 and a molecular weight of 287.36 g/mol. Its IUPAC name is (1R)-N-[[(4R)-4-hydroxy-2,3-dihydrochromen-4-yl]methyl]cyclohex-3-ene-1-carboxamide.
| Compound Name | (1R)-N-[[(4R)-4-hydroxy-2,3-dihydrochromen-4-yl]methyl]cyclohex-3-ene-1-carboxamide |
|---|---|
| PubChem CID | 95984877 |
| Molecular Formula | C17H21NO3 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | (1R)-N-[[(4R)-4-hydroxy-2,3-dihydrochromen-4-yl]methyl]cyclohex-3-ene-1-carboxamide |
| SMILES | O=C(NC[C@@]1(O)CCOc2ccccc21)[C@H]1CC=CCC1 |
| InChI | InChI=1S/C17H21NO3/c19-16(13-6-2-1-3-7-13)18-12-17(20)10-11-21-15-9-5-4-8-14(15)17/h1-2,4-5,8-9,13,20H,3,6-7,10-12H2,(H,18,19)/t13-,17-/m0/s1 |
| InChIKey | GCRIKYHPPHQELH-GUYCJALGSA-N |
| XLogP | 2.13 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|