C19H22N2O4 — CID 95985154
N-[(2-hydroxy-5,6,7,8-tetrahydronaphthalen-1-yl)methyl]-5-[(2S)-oxolan-2-yl]-1,3-oxazole-4-carboxamide (PubChem CID 95985154) has the molecular formula C19H22N2O4 and a molecular weight of 342.40 g/mol. Its IUPAC name is N-[(2-hydroxy-5,6,7,8-tetrahydronaphthalen-1-yl)methyl]-5-[(2S)-oxolan-2-yl]-1,3-oxazole-4-carboxamide.
| Compound Name | N-[(2-hydroxy-5,6,7,8-tetrahydronaphthalen-1-yl)methyl]-5-[(2S)-oxolan-2-yl]-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 95985154 |
| Molecular Formula | C19H22N2O4 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | N-[(2-hydroxy-5,6,7,8-tetrahydronaphthalen-1-yl)methyl]-5-[(2S)-oxolan-2-yl]-1,3-oxazole-4-carboxamide |
| SMILES | O=C(NCc1c(O)ccc2c1CCCC2)c1ncoc1[C@@H]1CCCO1 |
| InChI | InChI=1S/C19H22N2O4/c22-15-8-7-12-4-1-2-5-13(12)14(15)10-20-19(23)17-18(25-11-21-17)16-6-3-9-24-16/h7-8,11,16,22H,1-6,9-10H2,(H,20,23)/t16-/m0/s1 |
| InChIKey | JSSXXMBATSHODN-INIZCTEOSA-N |
| XLogP | 3.04 |
| TPSA | 84.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|