About (4R)-4-(hydroxyamino)-5,5-dimethyl-3-phenyl-1,3-thiazolidine-2-thione
(4R)-4-(hydroxyamino)-5,5-dimethyl-3-phenyl-1,3-thiazolidine-2-thione (PubChem CID 95988125) has the molecular formula C11H14N2OS2
and a molecular weight of 254.38 g/mol. Its IUPAC name is (4R)-4-(hydroxyamino)-5,5-dimethyl-3-phenyl-1,3-thiazolidine-2-thione.
Molecular Properties
| Compound Name | (4R)-4-(hydroxyamino)-5,5-dimethyl-3-phenyl-1,3-thiazolidine-2-thione |
| PubChem CID | 95988125 |
| Molecular Formula | C11H14N2OS2 |
| Molecular Weight | 254.38 g/mol |
| Exact Mass | 254.05 |
| IUPAC Name | (4R)-4-(hydroxyamino)-5,5-dimethyl-3-phenyl-1,3-thiazolidine-2-thione |
| SMILES | CC1(C)SC(=S)N(c2ccccc2)[C@@H]1NO |
| InChI | InChI=1S/C11H14N2OS2/c1-11(2)9(12-14)13(10(15)16-11)8-6-4-3-5-7-8/h3-7,9,12,14H,1-2H3/t9-/m0/s1 |
| InChIKey | KSBNCMSMDJAXBC-VIFPVBQESA-N |
| XLogP | 2.61 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.38 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze (4R)-4-(hydroxyamino)-5,5-dimethyl-3-phenyl-1,3-thiazolidine-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-4-(hydroxyamino)-5,5-dimethyl-3-phenyl-1,3-thiazolidine-2-thione?
The IUPAC name of (4R)-4-(hydroxyamino)-5,5-dimethyl-3-phenyl-1,3-thiazolidine-2-thione (CID 95988125) is (4R)-4-(hydroxyamino)-5,5-dimethyl-3-phenyl-1,3-thiazolidine-2-thione.
What is the SMILES notation for (4R)-4-(hydroxyamino)-5,5-dimethyl-3-phenyl-1,3-thiazolidine-2-thione?
The canonical SMILES for (4R)-4-(hydroxyamino)-5,5-dimethyl-3-phenyl-1,3-thiazolidine-2-thione is CC1(C)SC(=S)N(c2ccccc2)[C@@H]1NO.
What is the InChIKey of (4R)-4-(hydroxyamino)-5,5-dimethyl-3-phenyl-1,3-thiazolidine-2-thione?
The InChIKey is KSBNCMSMDJAXBC-VIFPVBQESA-N. The full InChI is InChI=1S/C11H14N2OS2/c1-11(2)9(12-14)13(10(15)16-11)8-6-4-3-5-7-8/h3-7,9,12,14H,1-2H3/t9-/m0/s1.
What are the key properties of (4R)-4-(hydroxyamino)-5,5-dimethyl-3-phenyl-1,3-thiazolidine-2-thione?
(4R)-4-(hydroxyamino)-5,5-dimethyl-3-phenyl-1,3-thiazolidine-2-thione has a molecular weight of 254.38 g/mol, XLogP of 2.61, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-4-(hydroxyamino)-5,5-dimethyl-3-phenyl-1,3-thiazolidine-2-thione is sourced from PubChem (CID 95988125), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).