C14H17N3O3S2 — CID 95988323
(2R)-2-[(3-amino-12,12-dimethyl-11-oxa-8-thia-4,6-diazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-5-yl)sulfanyl]propanoic acid (PubChem CID 95988323) has the molecular formula C14H17N3O3S2 and a molecular weight of 339.44 g/mol. Its IUPAC name is (2R)-2-[(3-amino-12,12-dimethyl-11-oxa-8-thia-4,6-diazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-5-yl)sulfanyl]propanoic acid.
| Compound Name | (2R)-2-[(3-amino-12,12-dimethyl-11-oxa-8-thia-4,6-diazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-5-yl)sulfanyl]propanoic acid |
|---|---|
| PubChem CID | 95988323 |
| Molecular Formula | C14H17N3O3S2 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.07 |
| IUPAC Name | (2R)-2-[(3-amino-12,12-dimethyl-11-oxa-8-thia-4,6-diazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-5-yl)sulfanyl]propanoic acid |
| SMILES | C[C@@H](Sc1nc(N)c2c3c(sc2n1)COC(C)(C)C3)C(=O)O |
| InChI | InChI=1S/C14H17N3O3S2/c1-6(12(18)19)21-13-16-10(15)9-7-4-14(2,3)20-5-8(7)22-11(9)17-13/h6H,4-5H2,1-3H3,(H,18,19)(H2,15,16,17)/t6-/m1/s1 |
| InChIKey | NFANDDYKZBVSFI-ZCFIWIBFSA-N |
| XLogP | 2.69 |
| TPSA | 98.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |