About methyl N-benzyl-N-[(3S,5R)-5-tert-butyl-2-oxooxolan-3-yl]carbamate
methyl N-benzyl-N-[(3S,5R)-5-tert-butyl-2-oxooxolan-3-yl]carbamate (PubChem CID 95988525) has the molecular formula C17H23NO4
and a molecular weight of 305.37 g/mol. Its IUPAC name is methyl N-benzyl-N-[(3S,5R)-5-tert-butyl-2-oxooxolan-3-yl]carbamate.
Molecular Properties
| Compound Name | methyl N-benzyl-N-[(3S,5R)-5-tert-butyl-2-oxooxolan-3-yl]carbamate |
| PubChem CID | 95988525 |
| Molecular Formula | C17H23NO4 |
| Molecular Weight | 305.37 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | methyl N-benzyl-N-[(3S,5R)-5-tert-butyl-2-oxooxolan-3-yl]carbamate |
| SMILES | COC(=O)N(Cc1ccccc1)[C@H]1C[C@H](C(C)(C)C)OC1=O |
| InChI | InChI=1S/C17H23NO4/c1-17(2,3)14-10-13(15(19)22-14)18(16(20)21-4)11-12-8-6-5-7-9-12/h5-9,13-14H,10-11H2,1-4H3/t13-,14+/m0/s1 |
| InChIKey | FWYGHYKMEPEJDC-UONOGXRCSA-N |
| XLogP | 2.99 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.37 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl N-benzyl-N-[(3S,5R)-5-tert-butyl-2-oxooxolan-3-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N-benzyl-N-[(3S,5R)-5-tert-butyl-2-oxooxolan-3-yl]carbamate?
The IUPAC name of methyl N-benzyl-N-[(3S,5R)-5-tert-butyl-2-oxooxolan-3-yl]carbamate (CID 95988525) is methyl N-benzyl-N-[(3S,5R)-5-tert-butyl-2-oxooxolan-3-yl]carbamate.
What is the SMILES notation for methyl N-benzyl-N-[(3S,5R)-5-tert-butyl-2-oxooxolan-3-yl]carbamate?
The canonical SMILES for methyl N-benzyl-N-[(3S,5R)-5-tert-butyl-2-oxooxolan-3-yl]carbamate is COC(=O)N(Cc1ccccc1)[C@H]1C[C@H](C(C)(C)C)OC1=O.
What is the InChIKey of methyl N-benzyl-N-[(3S,5R)-5-tert-butyl-2-oxooxolan-3-yl]carbamate?
The InChIKey is FWYGHYKMEPEJDC-UONOGXRCSA-N. The full InChI is InChI=1S/C17H23NO4/c1-17(2,3)14-10-13(15(19)22-14)18(16(20)21-4)11-12-8-6-5-7-9-12/h5-9,13-14H,10-11H2,1-4H3/t13-,14+/m0/s1.
What are the key properties of methyl N-benzyl-N-[(3S,5R)-5-tert-butyl-2-oxooxolan-3-yl]carbamate?
methyl N-benzyl-N-[(3S,5R)-5-tert-butyl-2-oxooxolan-3-yl]carbamate has a molecular weight of 305.37 g/mol, XLogP of 2.99, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-benzyl-N-[(3S,5R)-5-tert-butyl-2-oxooxolan-3-yl]carbamate is sourced from PubChem (CID 95988525), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).