About 2-[(2S,3S)-2-(2-hydroxyphenyl)-4-oxo-3-phenoxyazetidin-1-yl]acetic acid
2-[(2S,3S)-2-(2-hydroxyphenyl)-4-oxo-3-phenoxyazetidin-1-yl]acetic acid (PubChem CID 95988582) has the molecular formula C17H15NO5
and a molecular weight of 313.31 g/mol. Its IUPAC name is 2-[(2S,3S)-2-(2-hydroxyphenyl)-4-oxo-3-phenoxyazetidin-1-yl]acetic acid.
Molecular Properties
| Compound Name | 2-[(2S,3S)-2-(2-hydroxyphenyl)-4-oxo-3-phenoxyazetidin-1-yl]acetic acid |
| PubChem CID | 95988582 |
| Molecular Formula | C17H15NO5 |
| Molecular Weight | 313.31 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | 2-[(2S,3S)-2-(2-hydroxyphenyl)-4-oxo-3-phenoxyazetidin-1-yl]acetic acid |
| SMILES | O=C(O)CN1C(=O)[C@@H](Oc2ccccc2)[C@@H]1c1ccccc1O |
| InChI | InChI=1S/C17H15NO5/c19-13-9-5-4-8-12(13)15-16(17(22)18(15)10-14(20)21)23-11-6-2-1-3-7-11/h1-9,15-16,19H,10H2,(H,20,21)/t15-,16-/m0/s1 |
| InChIKey | XCUTXZYWXRZWSL-HOTGVXAUSA-N |
| XLogP | 1.81 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.31 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2S,3S)-2-(2-hydroxyphenyl)-4-oxo-3-phenoxyazetidin-1-yl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2S,3S)-2-(2-hydroxyphenyl)-4-oxo-3-phenoxyazetidin-1-yl]acetic acid?
The IUPAC name of 2-[(2S,3S)-2-(2-hydroxyphenyl)-4-oxo-3-phenoxyazetidin-1-yl]acetic acid (CID 95988582) is 2-[(2S,3S)-2-(2-hydroxyphenyl)-4-oxo-3-phenoxyazetidin-1-yl]acetic acid.
What is the SMILES notation for 2-[(2S,3S)-2-(2-hydroxyphenyl)-4-oxo-3-phenoxyazetidin-1-yl]acetic acid?
The canonical SMILES for 2-[(2S,3S)-2-(2-hydroxyphenyl)-4-oxo-3-phenoxyazetidin-1-yl]acetic acid is O=C(O)CN1C(=O)[C@@H](Oc2ccccc2)[C@@H]1c1ccccc1O.
What is the InChIKey of 2-[(2S,3S)-2-(2-hydroxyphenyl)-4-oxo-3-phenoxyazetidin-1-yl]acetic acid?
The InChIKey is XCUTXZYWXRZWSL-HOTGVXAUSA-N. The full InChI is InChI=1S/C17H15NO5/c19-13-9-5-4-8-12(13)15-16(17(22)18(15)10-14(20)21)23-11-6-2-1-3-7-11/h1-9,15-16,19H,10H2,(H,20,21)/t15-,16-/m0/s1.
What are the key properties of 2-[(2S,3S)-2-(2-hydroxyphenyl)-4-oxo-3-phenoxyazetidin-1-yl]acetic acid?
2-[(2S,3S)-2-(2-hydroxyphenyl)-4-oxo-3-phenoxyazetidin-1-yl]acetic acid has a molecular weight of 313.31 g/mol, XLogP of 1.81, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2S,3S)-2-(2-hydroxyphenyl)-4-oxo-3-phenoxyazetidin-1-yl]acetic acid is sourced from PubChem (CID 95988582), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).