C16H17N3O5 — CID 95988604
ethyl (5R)-7-(3-methoxyphenyl)-6,8-dioxo-2,3,7-triazaspiro[4.4]non-3-ene-4-carboxylate (PubChem CID 95988604) has the molecular formula C16H17N3O5 and a molecular weight of 331.33 g/mol. Its IUPAC name is ethyl (5R)-7-(3-methoxyphenyl)-6,8-dioxo-2,3,7-triazaspiro[4.4]non-3-ene-4-carboxylate.
| Compound Name | ethyl (5R)-7-(3-methoxyphenyl)-6,8-dioxo-2,3,7-triazaspiro[4.4]non-3-ene-4-carboxylate |
|---|---|
| PubChem CID | 95988604 |
| Molecular Formula | C16H17N3O5 |
| Molecular Weight | 331.33 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | ethyl (5R)-7-(3-methoxyphenyl)-6,8-dioxo-2,3,7-triazaspiro[4.4]non-3-ene-4-carboxylate |
| SMILES | CCOC(=O)C1=NNC[C@]12CC(=O)N(c1cccc(OC)c1)C2=O |
| InChI | InChI=1S/C16H17N3O5/c1-3-24-14(21)13-16(9-17-18-13)8-12(20)19(15(16)22)10-5-4-6-11(7-10)23-2/h4-7,17H,3,8-9H2,1-2H3/t16-/m1/s1 |
| InChIKey | HRBFOXBAHYQZCN-MRXNPFEDSA-N |
| XLogP | 0.47 |
| TPSA | 97.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.33 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|