C21H19NO5 — CID 95989688
dimethyl (2R,3R,4S,5S)-2-cyano-2,5-diphenyloxolane-3,4-dicarboxylate (PubChem CID 95989688) has the molecular formula C21H19NO5 and a molecular weight of 365.39 g/mol. Its IUPAC name is dimethyl (2R,3R,4S,5S)-2-cyano-2,5-diphenyloxolane-3,4-dicarboxylate.
| Compound Name | dimethyl (2R,3R,4S,5S)-2-cyano-2,5-diphenyloxolane-3,4-dicarboxylate |
|---|---|
| PubChem CID | 95989688 |
| Molecular Formula | C21H19NO5 |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.13 |
| IUPAC Name | dimethyl (2R,3R,4S,5S)-2-cyano-2,5-diphenyloxolane-3,4-dicarboxylate |
| SMILES | COC(=O)[C@@H]1[C@@H](c2ccccc2)O[C@@](C#N)(c2ccccc2)[C@@H]1C(=O)OC |
| InChI | InChI=1S/C21H19NO5/c1-25-19(23)16-17(20(24)26-2)21(13-22,15-11-7-4-8-12-15)27-18(16)14-9-5-3-6-10-14/h3-12,16-18H,1-2H3/t16-,17-,18+,21-/m0/s1 |
| InChIKey | GEHPXHQUBUBGHP-UGNRZPKXSA-N |
| XLogP | 2.76 |
| TPSA | 85.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |