C13H9NO6 — CID 95989830
cis-(1R,2S)-1-(1,3-dioxoisoindol-2-yl)cyclopropane-1,2-dicarboxylic acid (PubChem CID 95989830) has the molecular formula C13H9NO6 and a molecular weight of 275.22 g/mol. Its IUPAC name is cis-(1R,2S)-1-(1,3-dioxoisoindol-2-yl)cyclopropane-1,2-dicarboxylic acid.
| Compound Name | cis-(1R,2S)-1-(1,3-dioxoisoindol-2-yl)cyclopropane-1,2-dicarboxylic acid |
|---|---|
| PubChem CID | 95989830 |
| Molecular Formula | C13H9NO6 |
| Molecular Weight | 275.22 g/mol |
| Exact Mass | 275.04 |
| IUPAC Name | cis-(1R,2S)-1-(1,3-dioxoisoindol-2-yl)cyclopropane-1,2-dicarboxylic acid |
| SMILES | O=C(O)[C@H]1C[C@@]1(C(=O)O)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C13H9NO6/c15-9-6-3-1-2-4-7(6)10(16)14(9)13(12(19)20)5-8(13)11(17)18/h1-4,8H,5H2,(H,17,18)(H,19,20)/t8-,13-/m1/s1 |
| InChIKey | HFDITUNDDSWCNI-AMIZOPFISA-N |
| XLogP | 0.21 |
| TPSA | 111.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.22 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|