C18H21NO2 — CID 95990665
(2S)-2-(2,4-dimethylphenoxy)-N-methyl-N-phenylpropanamide (PubChem CID 95990665) has the molecular formula C18H21NO2 and a molecular weight of 283.37 g/mol. Its IUPAC name is (2S)-2-(2,4-dimethylphenoxy)-N-methyl-N-phenylpropanamide.
| Compound Name | (2S)-2-(2,4-dimethylphenoxy)-N-methyl-N-phenylpropanamide |
|---|---|
| PubChem CID | 95990665 |
| Molecular Formula | C18H21NO2 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | (2S)-2-(2,4-dimethylphenoxy)-N-methyl-N-phenylpropanamide |
| SMILES | Cc1ccc(O[C@@H](C)C(=O)N(C)c2ccccc2)c(C)c1 |
| InChI | InChI=1S/C18H21NO2/c1-13-10-11-17(14(2)12-13)21-15(3)18(20)19(4)16-8-6-5-7-9-16/h5-12,15H,1-4H3/t15-/m0/s1 |
| InChIKey | WNFJCZMSYNJIGK-HNNXBMFYSA-N |
| XLogP | 3.73 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |