About 2-methyl-5-(4-methyl-1,3-oxazol-5-yl)-1H-imidazole-4-carboxylic acid
2-methyl-5-(4-methyl-1,3-oxazol-5-yl)-1H-imidazole-4-carboxylic acid (PubChem CID 95991034) has the molecular formula C9H9N3O3
and a molecular weight of 207.19 g/mol. Its IUPAC name is 2-methyl-5-(4-methyl-1,3-oxazol-5-yl)-1H-imidazole-4-carboxylic acid.
Molecular Properties
| Compound Name | 2-methyl-5-(4-methyl-1,3-oxazol-5-yl)-1H-imidazole-4-carboxylic acid |
| PubChem CID | 95991034 |
| Molecular Formula | C9H9N3O3 |
| Molecular Weight | 207.19 g/mol |
| Exact Mass | 207.06 |
| IUPAC Name | 2-methyl-5-(4-methyl-1,3-oxazol-5-yl)-1H-imidazole-4-carboxylic acid |
| SMILES | Cc1nc(C(=O)O)c(-c2ocnc2C)[nH]1 |
| InChI | InChI=1S/C9H9N3O3/c1-4-8(15-3-10-4)6-7(9(13)14)12-5(2)11-6/h3H,1-2H3,(H,11,12)(H,13,14) |
| InChIKey | SWLUGTMZKANZOE-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 92.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.19 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-methyl-5-(4-methyl-1,3-oxazol-5-yl)-1H-imidazole-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-5-(4-methyl-1,3-oxazol-5-yl)-1H-imidazole-4-carboxylic acid?
The IUPAC name of 2-methyl-5-(4-methyl-1,3-oxazol-5-yl)-1H-imidazole-4-carboxylic acid (CID 95991034) is 2-methyl-5-(4-methyl-1,3-oxazol-5-yl)-1H-imidazole-4-carboxylic acid.
What is the SMILES notation for 2-methyl-5-(4-methyl-1,3-oxazol-5-yl)-1H-imidazole-4-carboxylic acid?
The canonical SMILES for 2-methyl-5-(4-methyl-1,3-oxazol-5-yl)-1H-imidazole-4-carboxylic acid is Cc1nc(C(=O)O)c(-c2ocnc2C)[nH]1.
What is the InChIKey of 2-methyl-5-(4-methyl-1,3-oxazol-5-yl)-1H-imidazole-4-carboxylic acid?
The InChIKey is SWLUGTMZKANZOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N3O3/c1-4-8(15-3-10-4)6-7(9(13)14)12-5(2)11-6/h3H,1-2H3,(H,11,12)(H,13,14).
What are the key properties of 2-methyl-5-(4-methyl-1,3-oxazol-5-yl)-1H-imidazole-4-carboxylic acid?
2-methyl-5-(4-methyl-1,3-oxazol-5-yl)-1H-imidazole-4-carboxylic acid has a molecular weight of 207.19 g/mol, XLogP of 1.38, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-5-(4-methyl-1,3-oxazol-5-yl)-1H-imidazole-4-carboxylic acid is sourced from PubChem (CID 95991034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).