C10H9N5O — CID 95991204
4-(1-methylbenzimidazol-5-yl)-1,2,5-oxadiazol-3-amine (PubChem CID 95991204) has the molecular formula C10H9N5O and a molecular weight of 215.22 g/mol. Its IUPAC name is 4-(1-methylbenzimidazol-5-yl)-1,2,5-oxadiazol-3-amine.
| Compound Name | 4-(1-methylbenzimidazol-5-yl)-1,2,5-oxadiazol-3-amine |
|---|---|
| PubChem CID | 95991204 |
| Molecular Formula | C10H9N5O |
| Molecular Weight | 215.22 g/mol |
| Exact Mass | 215.08 |
| IUPAC Name | 4-(1-methylbenzimidazol-5-yl)-1,2,5-oxadiazol-3-amine |
| SMILES | Cn1cnc2cc(-c3nonc3N)ccc21 |
| InChI | InChI=1S/C10H9N5O/c1-15-5-12-7-4-6(2-3-8(7)15)9-10(11)14-16-13-9/h2-5H,1H3,(H2,11,14) |
| InChIKey | VSLGURBJDMPULY-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 82.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.22 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |