About Benzadehyde O-benzyloxime
Benzadehyde O-benzyloxime (PubChem CID 9602276) has the molecular formula C14H13NO
and a molecular weight of 211.26 g/mol. Its IUPAC name is (E)-1-phenyl-N-phenylmethoxymethanimine.
Molecular Properties
| Compound Name | Benzadehyde O-benzyloxime |
| PubChem CID | 9602276 |
| Molecular Formula | C14H13NO |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.10 |
| IUPAC Name | (E)-1-phenyl-N-phenylmethoxymethanimine |
| SMILES | C1=CC=C(C=C1)CO/N=C/C2=CC=CC=C2 |
| InChI | InChI=1S/C14H13NO/c1-3-7-13(8-4-1)11-15-16-12-14-9-5-2-6-10-14/h1-11H,12H2/b15-11+ |
| InChIKey | CVBQDSHWPRCDRQ-RVDMUPIBSA-N |
| XLogP | 3.50 |
| TPSA | 21.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | 203 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze Benzadehyde O-benzyloxime with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Benzadehyde O-benzyloxime?
The IUPAC name of Benzadehyde O-benzyloxime (CID 9602276) is (E)-1-phenyl-N-phenylmethoxymethanimine.
What is the SMILES notation for Benzadehyde O-benzyloxime?
The canonical SMILES for Benzadehyde O-benzyloxime is C1=CC=C(C=C1)CO/N=C/C2=CC=CC=C2.
What is the InChIKey of Benzadehyde O-benzyloxime?
The InChIKey is CVBQDSHWPRCDRQ-RVDMUPIBSA-N. The full InChI is InChI=1S/C14H13NO/c1-3-7-13(8-4-1)11-15-16-12-14-9-5-2-6-10-14/h1-11H,12H2/b15-11+.
What are the key properties of Benzadehyde O-benzyloxime?
Benzadehyde O-benzyloxime has a molecular weight of 211.26 g/mol, XLogP of 3.50, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for Benzadehyde O-benzyloxime is sourced from PubChem (CID 9602276), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).