About N-benzyl-4-bromoaniline
N-benzyl-4-bromoaniline (PubChem CID 961575) has the molecular formula C13H12BrN
and a molecular weight of 262.15 g/mol. Its IUPAC name is N-benzyl-4-bromoaniline.
Molecular Properties
| Compound Name | N-benzyl-4-bromoaniline |
| PubChem CID | 961575 |
| Molecular Formula | C13H12BrN |
| Molecular Weight | 262.15 g/mol |
| Exact Mass | 261.02 |
| IUPAC Name | N-benzyl-4-bromoaniline |
| SMILES | Brc1ccc(NCc2ccccc2)cc1 |
| InChI | InChI=1S/C13H12BrN/c14-12-6-8-13(9-7-12)15-10-11-4-2-1-3-5-11/h1-9,15H,10H2 |
| InChIKey | AZLKZLKCCRFAAE-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.15 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-benzyl-4-bromoaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-4-bromoaniline?
The IUPAC name of N-benzyl-4-bromoaniline (CID 961575) is N-benzyl-4-bromoaniline.
What is the SMILES notation for N-benzyl-4-bromoaniline?
The canonical SMILES for N-benzyl-4-bromoaniline is Brc1ccc(NCc2ccccc2)cc1.
What is the InChIKey of N-benzyl-4-bromoaniline?
The InChIKey is AZLKZLKCCRFAAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12BrN/c14-12-6-8-13(9-7-12)15-10-11-4-2-1-3-5-11/h1-9,15H,10H2.
What are the key properties of N-benzyl-4-bromoaniline?
N-benzyl-4-bromoaniline has a molecular weight of 262.15 g/mol, XLogP of 4.06, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-4-bromoaniline is sourced from PubChem (CID 961575), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).