C15H17NO2S2 — CID 961910
N-(2,6-dimethylphenyl)-4-methylsulfanylbenzenesulfonamide (PubChem CID 961910) has the molecular formula C15H17NO2S2 and a molecular weight of 307.44 g/mol. Its IUPAC name is N-(2,6-dimethylphenyl)-4-methylsulfanylbenzenesulfonamide.
| Compound Name | N-(2,6-dimethylphenyl)-4-methylsulfanylbenzenesulfonamide |
|---|---|
| PubChem CID | 961910 |
| Molecular Formula | C15H17NO2S2 |
| Molecular Weight | 307.44 g/mol |
| Exact Mass | 307.07 |
| IUPAC Name | N-(2,6-dimethylphenyl)-4-methylsulfanylbenzenesulfonamide |
| SMILES | CSc1ccc(S(=O)(=O)Nc2c(C)cccc2C)cc1 |
| InChI | InChI=1S/C15H17NO2S2/c1-11-5-4-6-12(2)15(11)16-20(17,18)14-9-7-13(19-3)8-10-14/h4-10,16H,1-3H3 |
| InChIKey | JHKMOYWOPLYKPX-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.44 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |