C16H9N3O4 — CID 962092
4-(4-acetylphenoxy)-5-nitrobenzene-1,2-dicarbonitrile (PubChem CID 962092) has the molecular formula C16H9N3O4 and a molecular weight of 307.27 g/mol. Its IUPAC name is 4-(4-acetylphenoxy)-5-nitrobenzene-1,2-dicarbonitrile.
| Compound Name | 4-(4-acetylphenoxy)-5-nitrobenzene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 962092 |
| Molecular Formula | C16H9N3O4 |
| Molecular Weight | 307.27 g/mol |
| Exact Mass | 307.06 |
| IUPAC Name | 4-(4-acetylphenoxy)-5-nitrobenzene-1,2-dicarbonitrile |
| SMILES | CC(=O)c1ccc(Oc2cc(C#N)c(C#N)cc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C16H9N3O4/c1-10(20)11-2-4-14(5-3-11)23-16-7-13(9-18)12(8-17)6-15(16)19(21)22/h2-7H,1H3 |
| InChIKey | MJNJSLRQMRIVGD-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 117.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.27 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|