About 1-[(2,4-dichlorophenyl)methyl]-5,6-dimethylbenzimidazole
1-[(2,4-dichlorophenyl)methyl]-5,6-dimethylbenzimidazole (PubChem CID 962381) has the molecular formula C16H14Cl2N2
and a molecular weight of 305.21 g/mol. Its IUPAC name is 1-[(2,4-dichlorophenyl)methyl]-5,6-dimethylbenzimidazole.
Molecular Properties
| Compound Name | 1-[(2,4-dichlorophenyl)methyl]-5,6-dimethylbenzimidazole |
| PubChem CID | 962381 |
| Molecular Formula | C16H14Cl2N2 |
| Molecular Weight | 305.21 g/mol |
| Exact Mass | 304.05 |
| IUPAC Name | 1-[(2,4-dichlorophenyl)methyl]-5,6-dimethylbenzimidazole |
| SMILES | Cc1cc2ncn(Cc3ccc(Cl)cc3Cl)c2cc1C |
| InChI | InChI=1S/C16H14Cl2N2/c1-10-5-15-16(6-11(10)2)20(9-19-15)8-12-3-4-13(17)7-14(12)18/h3-7,9H,8H2,1-2H3 |
| InChIKey | MRRYXJGSMVFFHY-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 305.21 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[(2,4-dichlorophenyl)methyl]-5,6-dimethylbenzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2,4-dichlorophenyl)methyl]-5,6-dimethylbenzimidazole?
The IUPAC name of 1-[(2,4-dichlorophenyl)methyl]-5,6-dimethylbenzimidazole (CID 962381) is 1-[(2,4-dichlorophenyl)methyl]-5,6-dimethylbenzimidazole.
What is the SMILES notation for 1-[(2,4-dichlorophenyl)methyl]-5,6-dimethylbenzimidazole?
The canonical SMILES for 1-[(2,4-dichlorophenyl)methyl]-5,6-dimethylbenzimidazole is Cc1cc2ncn(Cc3ccc(Cl)cc3Cl)c2cc1C.
What is the InChIKey of 1-[(2,4-dichlorophenyl)methyl]-5,6-dimethylbenzimidazole?
The InChIKey is MRRYXJGSMVFFHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14Cl2N2/c1-10-5-15-16(6-11(10)2)20(9-19-15)8-12-3-4-13(17)7-14(12)18/h3-7,9H,8H2,1-2H3.
What are the key properties of 1-[(2,4-dichlorophenyl)methyl]-5,6-dimethylbenzimidazole?
1-[(2,4-dichlorophenyl)methyl]-5,6-dimethylbenzimidazole has a molecular weight of 305.21 g/mol, XLogP of 5.01, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2,4-dichlorophenyl)methyl]-5,6-dimethylbenzimidazole is sourced from PubChem (CID 962381), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).