C16H17ClN4OS — CID 962831
(7E)-7-[(4-chlorophenyl)methylidene]spiro[2,4-dihydro-[1,3]thiazolo[3,2-b][1,2,4,5]tetrazine-3,1'-cyclohexane]-6-one (PubChem CID 962831) has the molecular formula C16H17ClN4OS and a molecular weight of 348.86 g/mol. Its IUPAC name is (7E)-7-[(4-chlorophenyl)methylidene]spiro[2,4-dihydro-[1,3]thiazolo[3,2-b][1,2,4,5]tetrazine-3,1'-cyclohexane]-6-one.
| Compound Name | (7E)-7-[(4-chlorophenyl)methylidene]spiro[2,4-dihydro-[1,3]thiazolo[3,2-b][1,2,4,5]tetrazine-3,1'-cyclohexane]-6-one |
|---|---|
| PubChem CID | 962831 |
| Molecular Formula | C16H17ClN4OS |
| Molecular Weight | 348.86 g/mol |
| Exact Mass | 348.08 |
| IUPAC Name | (7E)-7-[(4-chlorophenyl)methylidene]spiro[2,4-dihydro-[1,3]thiazolo[3,2-b][1,2,4,5]tetrazine-3,1'-cyclohexane]-6-one |
| SMILES | O=c1/c(=C\c2ccc(Cl)cc2)sc2n1NC1(CCCCC1)NN=2 |
| InChI | InChI=1S/C16H17ClN4OS/c17-12-6-4-11(5-7-12)10-13-14(22)21-15(23-13)18-19-16(20-21)8-2-1-3-9-16/h4-7,10,19-20H,1-3,8-9H2/b13-10+ |
| InChIKey | HDHVIJKTWGZIFH-JLHYYAGUSA-N |
| XLogP | 1.73 |
| TPSA | 58.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.86 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |