C18H14N2S — CID 963414
2-benzyl-4-(1H-indol-3-yl)-1,3-thiazole (PubChem CID 963414) has the molecular formula C18H14N2S and a molecular weight of 290.39 g/mol. Its IUPAC name is 2-benzyl-4-(1H-indol-3-yl)-1,3-thiazole.
| Compound Name | 2-benzyl-4-(1H-indol-3-yl)-1,3-thiazole |
|---|---|
| PubChem CID | 963414 |
| Molecular Formula | C18H14N2S |
| Molecular Weight | 290.39 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | 2-benzyl-4-(1H-indol-3-yl)-1,3-thiazole |
| SMILES | c1ccc(Cc2nc(-c3c[nH]c4ccccc34)cs2)cc1 |
| InChI | InChI=1S/C18H14N2S/c1-2-6-13(7-3-1)10-18-20-17(12-21-18)15-11-19-16-9-5-4-8-14(15)16/h1-9,11-12,19H,10H2 |
| InChIKey | WDJMTGVQPKSATB-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.39 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |