About (3Z)-3-(1,3-benzodioxol-5-ylmethylidene)-1H-indol-2-one
(3Z)-3-(1,3-benzodioxol-5-ylmethylidene)-1H-indol-2-one (PubChem CID 964069) has the molecular formula C16H11NO3
and a molecular weight of 265.27 g/mol. Its IUPAC name is (3Z)-3-(1,3-benzodioxol-5-ylmethylidene)-1H-indol-2-one.
Molecular Properties
| Compound Name | (3Z)-3-(1,3-benzodioxol-5-ylmethylidene)-1H-indol-2-one |
| PubChem CID | 964069 |
| Molecular Formula | C16H11NO3 |
| Molecular Weight | 265.27 g/mol |
| Exact Mass | 265.07 |
| IUPAC Name | (3Z)-3-(1,3-benzodioxol-5-ylmethylidene)-1H-indol-2-one |
| SMILES | O=C1Nc2ccccc2/C1=C/c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C16H11NO3/c18-16-12(11-3-1-2-4-13(11)17-16)7-10-5-6-14-15(8-10)20-9-19-14/h1-8H,9H2,(H,17,18)/b12-7- |
| InChIKey | UBOQMVKWCXXWIP-GHXNOFRVSA-N |
| XLogP | 2.91 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.27 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze (3Z)-3-(1,3-benzodioxol-5-ylmethylidene)-1H-indol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-3-(1,3-benzodioxol-5-ylmethylidene)-1H-indol-2-one?
The IUPAC name of (3Z)-3-(1,3-benzodioxol-5-ylmethylidene)-1H-indol-2-one (CID 964069) is (3Z)-3-(1,3-benzodioxol-5-ylmethylidene)-1H-indol-2-one.
What is the SMILES notation for (3Z)-3-(1,3-benzodioxol-5-ylmethylidene)-1H-indol-2-one?
The canonical SMILES for (3Z)-3-(1,3-benzodioxol-5-ylmethylidene)-1H-indol-2-one is O=C1Nc2ccccc2/C1=C/c1ccc2c(c1)OCO2.
What is the InChIKey of (3Z)-3-(1,3-benzodioxol-5-ylmethylidene)-1H-indol-2-one?
The InChIKey is UBOQMVKWCXXWIP-GHXNOFRVSA-N. The full InChI is InChI=1S/C16H11NO3/c18-16-12(11-3-1-2-4-13(11)17-16)7-10-5-6-14-15(8-10)20-9-19-14/h1-8H,9H2,(H,17,18)/b12-7-.
What are the key properties of (3Z)-3-(1,3-benzodioxol-5-ylmethylidene)-1H-indol-2-one?
(3Z)-3-(1,3-benzodioxol-5-ylmethylidene)-1H-indol-2-one has a molecular weight of 265.27 g/mol, XLogP of 2.91, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-3-(1,3-benzodioxol-5-ylmethylidene)-1H-indol-2-one is sourced from PubChem (CID 964069), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).