About benzo[e]perimidin-7-one
benzo[e]perimidin-7-one (PubChem CID 964647) has the molecular formula C15H8N2O
and a molecular weight of 232.24 g/mol. Its IUPAC name is benzo[e]perimidin-7-one.
Molecular Properties
| Compound Name | benzo[e]perimidin-7-one |
| PubChem CID | 964647 |
| Molecular Formula | C15H8N2O |
| Molecular Weight | 232.24 g/mol |
| Exact Mass | 232.06 |
| IUPAC Name | benzo[e]perimidin-7-one |
| SMILES | O=C1c2ccccc2-c2ncnc3cccc1c23 |
| InChI | InChI=1S/C15H8N2O/c18-15-10-5-2-1-4-9(10)14-13-11(15)6-3-7-12(13)16-8-17-14/h1-8H |
| InChIKey | WWXLKPRGAXWHFO-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.24 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze benzo[e]perimidin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzo[e]perimidin-7-one?
The IUPAC name of benzo[e]perimidin-7-one (CID 964647) is benzo[e]perimidin-7-one.
What is the SMILES notation for benzo[e]perimidin-7-one?
The canonical SMILES for benzo[e]perimidin-7-one is O=C1c2ccccc2-c2ncnc3cccc1c23.
What is the InChIKey of benzo[e]perimidin-7-one?
The InChIKey is WWXLKPRGAXWHFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H8N2O/c18-15-10-5-2-1-4-9(10)14-13-11(15)6-3-7-12(13)16-8-17-14/h1-8H.
What are the key properties of benzo[e]perimidin-7-one?
benzo[e]perimidin-7-one has a molecular weight of 232.24 g/mol, XLogP of 2.84, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzo[e]perimidin-7-one is sourced from PubChem (CID 964647), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).