C18H26N4O3 — CID 96500816
[4-[4-[(1S,2S)-2-hydroxycyclopentyl]piperazine-1-carbonyl]phenyl]methylurea (PubChem CID 96500816) has the molecular formula C18H26N4O3 and a molecular weight of 346.43 g/mol. Its IUPAC name is [4-[4-[(1S,2S)-2-hydroxycyclopentyl]piperazine-1-carbonyl]phenyl]methylurea.
| Compound Name | [4-[4-[(1S,2S)-2-hydroxycyclopentyl]piperazine-1-carbonyl]phenyl]methylurea |
|---|---|
| PubChem CID | 96500816 |
| Molecular Formula | C18H26N4O3 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.20 |
| IUPAC Name | [4-[4-[(1S,2S)-2-hydroxycyclopentyl]piperazine-1-carbonyl]phenyl]methylurea |
| SMILES | NC(=O)NCc1ccc(C(=O)N2CCN([C@H]3CCC[C@@H]3O)CC2)cc1 |
| InChI | InChI=1S/C18H26N4O3/c19-18(25)20-12-13-4-6-14(7-5-13)17(24)22-10-8-21(9-11-22)15-2-1-3-16(15)23/h4-7,15-16,23H,1-3,8-12H2,(H3,19,20,25)/t15-,16-/m0/s1 |
| InChIKey | MWWPRKYPRIKJGW-HOTGVXAUSA-N |
| XLogP | 0.53 |
| TPSA | 98.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |