About [(1R)-1-(5-chloro-1,3-benzothiazol-2-yl)ethyl] (2R)-1,4-dioxane-2-carboxylate
[(1R)-1-(5-chloro-1,3-benzothiazol-2-yl)ethyl] (2R)-1,4-dioxane-2-carboxylate (PubChem CID 96503615) has the molecular formula C14H14ClNO4S
and a molecular weight of 327.79 g/mol. Its IUPAC name is [(1R)-1-(5-chloro-1,3-benzothiazol-2-yl)ethyl] (2R)-1,4-dioxane-2-carboxylate.
Molecular Properties
| Compound Name | [(1R)-1-(5-chloro-1,3-benzothiazol-2-yl)ethyl] (2R)-1,4-dioxane-2-carboxylate |
| PubChem CID | 96503615 |
| Molecular Formula | C14H14ClNO4S |
| Molecular Weight | 327.79 g/mol |
| Exact Mass | 327.03 |
| IUPAC Name | [(1R)-1-(5-chloro-1,3-benzothiazol-2-yl)ethyl] (2R)-1,4-dioxane-2-carboxylate |
| SMILES | C[C@@H](OC(=O)[C@H]1COCCO1)c1nc2cc(Cl)ccc2s1 |
| InChI | InChI=1S/C14H14ClNO4S/c1-8(20-14(17)11-7-18-4-5-19-11)13-16-10-6-9(15)2-3-12(10)21-13/h2-3,6,8,11H,4-5,7H2,1H3/t8-,11-/m1/s1 |
| InChIKey | UKOJKZJELAUEMV-LDYMZIIASA-N |
| XLogP | 2.97 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.79 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [(1R)-1-(5-chloro-1,3-benzothiazol-2-yl)ethyl] (2R)-1,4-dioxane-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R)-1-(5-chloro-1,3-benzothiazol-2-yl)ethyl] (2R)-1,4-dioxane-2-carboxylate?
The IUPAC name of [(1R)-1-(5-chloro-1,3-benzothiazol-2-yl)ethyl] (2R)-1,4-dioxane-2-carboxylate (CID 96503615) is [(1R)-1-(5-chloro-1,3-benzothiazol-2-yl)ethyl] (2R)-1,4-dioxane-2-carboxylate.
What is the SMILES notation for [(1R)-1-(5-chloro-1,3-benzothiazol-2-yl)ethyl] (2R)-1,4-dioxane-2-carboxylate?
The canonical SMILES for [(1R)-1-(5-chloro-1,3-benzothiazol-2-yl)ethyl] (2R)-1,4-dioxane-2-carboxylate is C[C@@H](OC(=O)[C@H]1COCCO1)c1nc2cc(Cl)ccc2s1.
What is the InChIKey of [(1R)-1-(5-chloro-1,3-benzothiazol-2-yl)ethyl] (2R)-1,4-dioxane-2-carboxylate?
The InChIKey is UKOJKZJELAUEMV-LDYMZIIASA-N. The full InChI is InChI=1S/C14H14ClNO4S/c1-8(20-14(17)11-7-18-4-5-19-11)13-16-10-6-9(15)2-3-12(10)21-13/h2-3,6,8,11H,4-5,7H2,1H3/t8-,11-/m1/s1.
What are the key properties of [(1R)-1-(5-chloro-1,3-benzothiazol-2-yl)ethyl] (2R)-1,4-dioxane-2-carboxylate?
[(1R)-1-(5-chloro-1,3-benzothiazol-2-yl)ethyl] (2R)-1,4-dioxane-2-carboxylate has a molecular weight of 327.79 g/mol, XLogP of 2.97, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R)-1-(5-chloro-1,3-benzothiazol-2-yl)ethyl] (2R)-1,4-dioxane-2-carboxylate is sourced from PubChem (CID 96503615), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).