C13H17FN2OS — CID 96503646
(2S,3S)-N-(3-fluorophenyl)-2,3-dimethylthiomorpholine-4-carboxamide (PubChem CID 96503646) has the molecular formula C13H17FN2OS and a molecular weight of 268.36 g/mol. Its IUPAC name is (2S,3S)-N-(3-fluorophenyl)-2,3-dimethylthiomorpholine-4-carboxamide.
| Compound Name | (2S,3S)-N-(3-fluorophenyl)-2,3-dimethylthiomorpholine-4-carboxamide |
|---|---|
| PubChem CID | 96503646 |
| Molecular Formula | C13H17FN2OS |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | (2S,3S)-N-(3-fluorophenyl)-2,3-dimethylthiomorpholine-4-carboxamide |
| SMILES | C[C@@H]1SCCN(C(=O)Nc2cccc(F)c2)[C@H]1C |
| InChI | InChI=1S/C13H17FN2OS/c1-9-10(2)18-7-6-16(9)13(17)15-12-5-3-4-11(14)8-12/h3-5,8-10H,6-7H2,1-2H3,(H,15,17)/t9-,10-/m0/s1 |
| InChIKey | AFDLCGJLRSYSAC-UWVGGRQHSA-N |
| XLogP | 3.18 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |