About (2S)-2-[2,4-bis(methylsulfonyl)anilino]-3,3-dimethylbutan-1-ol
(2S)-2-[2,4-bis(methylsulfonyl)anilino]-3,3-dimethylbutan-1-ol (PubChem CID 96504192) has the molecular formula C14H23NO5S2
and a molecular weight of 349.47 g/mol. Its IUPAC name is (2S)-2-[2,4-bis(methylsulfonyl)anilino]-3,3-dimethylbutan-1-ol.
Molecular Properties
| Compound Name | (2S)-2-[2,4-bis(methylsulfonyl)anilino]-3,3-dimethylbutan-1-ol |
| PubChem CID | 96504192 |
| Molecular Formula | C14H23NO5S2 |
| Molecular Weight | 349.47 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | (2S)-2-[2,4-bis(methylsulfonyl)anilino]-3,3-dimethylbutan-1-ol |
| SMILES | CC(C)(C)[C@@H](CO)Nc1ccc(S(C)(=O)=O)cc1S(C)(=O)=O |
| InChI | InChI=1S/C14H23NO5S2/c1-14(2,3)13(9-16)15-11-7-6-10(21(4,17)18)8-12(11)22(5,19)20/h6-8,13,15-16H,9H2,1-5H3/t13-/m1/s1 |
| InChIKey | AWTLRLDMSUOCFH-CYBMUJFWSA-N |
| XLogP | 1.31 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.47 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (2S)-2-[2,4-bis(methylsulfonyl)anilino]-3,3-dimethylbutan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-[2,4-bis(methylsulfonyl)anilino]-3,3-dimethylbutan-1-ol?
The IUPAC name of (2S)-2-[2,4-bis(methylsulfonyl)anilino]-3,3-dimethylbutan-1-ol (CID 96504192) is (2S)-2-[2,4-bis(methylsulfonyl)anilino]-3,3-dimethylbutan-1-ol.
What is the SMILES notation for (2S)-2-[2,4-bis(methylsulfonyl)anilino]-3,3-dimethylbutan-1-ol?
The canonical SMILES for (2S)-2-[2,4-bis(methylsulfonyl)anilino]-3,3-dimethylbutan-1-ol is CC(C)(C)[C@@H](CO)Nc1ccc(S(C)(=O)=O)cc1S(C)(=O)=O.
What is the InChIKey of (2S)-2-[2,4-bis(methylsulfonyl)anilino]-3,3-dimethylbutan-1-ol?
The InChIKey is AWTLRLDMSUOCFH-CYBMUJFWSA-N. The full InChI is InChI=1S/C14H23NO5S2/c1-14(2,3)13(9-16)15-11-7-6-10(21(4,17)18)8-12(11)22(5,19)20/h6-8,13,15-16H,9H2,1-5H3/t13-/m1/s1.
What are the key properties of (2S)-2-[2,4-bis(methylsulfonyl)anilino]-3,3-dimethylbutan-1-ol?
(2S)-2-[2,4-bis(methylsulfonyl)anilino]-3,3-dimethylbutan-1-ol has a molecular weight of 349.47 g/mol, XLogP of 1.31, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-[2,4-bis(methylsulfonyl)anilino]-3,3-dimethylbutan-1-ol is sourced from PubChem (CID 96504192), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).