C19H33F2N3O4 — CID 96504273
tert-butyl (4R,5R)-4-[[1-(2,2-difluoroethyl)piperidin-4-yl]carbamoyl]-2,2,5-trimethyl-1,3-oxazolidine-3-carboxylate (PubChem CID 96504273) has the molecular formula C19H33F2N3O4 and a molecular weight of 405.49 g/mol. Its IUPAC name is tert-butyl (4R,5R)-4-[[1-(2,2-difluoroethyl)piperidin-4-yl]carbamoyl]-2,2,5-trimethyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4R,5R)-4-[[1-(2,2-difluoroethyl)piperidin-4-yl]carbamoyl]-2,2,5-trimethyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 96504273 |
| Molecular Formula | C19H33F2N3O4 |
| Molecular Weight | 405.49 g/mol |
| Exact Mass | 405.24 |
| IUPAC Name | tert-butyl (4R,5R)-4-[[1-(2,2-difluoroethyl)piperidin-4-yl]carbamoyl]-2,2,5-trimethyl-1,3-oxazolidine-3-carboxylate |
| SMILES | C[C@H]1OC(C)(C)N(C(=O)OC(C)(C)C)[C@H]1C(=O)NC1CCN(CC(F)F)CC1 |
| InChI | InChI=1S/C19H33F2N3O4/c1-12-15(24(19(5,6)27-12)17(26)28-18(2,3)4)16(25)22-13-7-9-23(10-8-13)11-14(20)21/h12-15H,7-11H2,1-6H3,(H,22,25)/t12-,15-/m1/s1 |
| InChIKey | TXHAPOIPEDLPPY-IUODEOHRSA-N |
| XLogP | 2.59 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.49 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |