C17H33N3O2 — CID 96504380
(3R)-1-[(2S)-2-(diethylamino)butanoyl]-N-propylpiperidine-3-carboxamide (PubChem CID 96504380) has the molecular formula C17H33N3O2 and a molecular weight of 311.47 g/mol. Its IUPAC name is (3R)-1-[(2S)-2-(diethylamino)butanoyl]-N-propylpiperidine-3-carboxamide.
| Compound Name | (3R)-1-[(2S)-2-(diethylamino)butanoyl]-N-propylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 96504380 |
| Molecular Formula | C17H33N3O2 |
| Molecular Weight | 311.47 g/mol |
| Exact Mass | 311.26 |
| IUPAC Name | (3R)-1-[(2S)-2-(diethylamino)butanoyl]-N-propylpiperidine-3-carboxamide |
| SMILES | CCCNC(=O)[C@@H]1CCCN(C(=O)[C@H](CC)N(CC)CC)C1 |
| InChI | InChI=1S/C17H33N3O2/c1-5-11-18-16(21)14-10-9-12-20(13-14)17(22)15(6-2)19(7-3)8-4/h14-15H,5-13H2,1-4H3,(H,18,21)/t14-,15+/m1/s1 |
| InChIKey | OYIXXHCZBVSCPD-CABCVRRESA-N |
| XLogP | 1.87 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.47 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |