About [(2R,3R)-1-methyl-2-[4-(trifluoromethyl)phenyl]piperidin-3-yl]methyl 2-fluorobenzoate
[(2R,3R)-1-methyl-2-[4-(trifluoromethyl)phenyl]piperidin-3-yl]methyl 2-fluorobenzoate (PubChem CID 96504413) has the molecular formula C21H21F4NO2
and a molecular weight of 395.40 g/mol. Its IUPAC name is [(2R,3R)-1-methyl-2-[4-(trifluoromethyl)phenyl]piperidin-3-yl]methyl 2-fluorobenzoate.
Molecular Properties
| Compound Name | [(2R,3R)-1-methyl-2-[4-(trifluoromethyl)phenyl]piperidin-3-yl]methyl 2-fluorobenzoate |
| PubChem CID | 96504413 |
| Molecular Formula | C21H21F4NO2 |
| Molecular Weight | 395.40 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | [(2R,3R)-1-methyl-2-[4-(trifluoromethyl)phenyl]piperidin-3-yl]methyl 2-fluorobenzoate |
| SMILES | CN1CCC[C@@H](COC(=O)c2ccccc2F)C1c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C21H21F4NO2/c1-26-12-4-5-15(13-28-20(27)17-6-2-3-7-18(17)22)19(26)14-8-10-16(11-9-14)21(23,24)25/h2-3,6-11,15,19H,4-5,12-13H2,1H3/t15-,19?/m0/s1 |
| InChIKey | WSPOOGDTPZVEJW-FUKCDUGKSA-N |
| XLogP | 5.08 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 395.40 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(2R,3R)-1-methyl-2-[4-(trifluoromethyl)phenyl]piperidin-3-yl]methyl 2-fluorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R,3R)-1-methyl-2-[4-(trifluoromethyl)phenyl]piperidin-3-yl]methyl 2-fluorobenzoate?
The IUPAC name of [(2R,3R)-1-methyl-2-[4-(trifluoromethyl)phenyl]piperidin-3-yl]methyl 2-fluorobenzoate (CID 96504413) is [(2R,3R)-1-methyl-2-[4-(trifluoromethyl)phenyl]piperidin-3-yl]methyl 2-fluorobenzoate.
What is the SMILES notation for [(2R,3R)-1-methyl-2-[4-(trifluoromethyl)phenyl]piperidin-3-yl]methyl 2-fluorobenzoate?
The canonical SMILES for [(2R,3R)-1-methyl-2-[4-(trifluoromethyl)phenyl]piperidin-3-yl]methyl 2-fluorobenzoate is CN1CCC[C@@H](COC(=O)c2ccccc2F)C1c1ccc(C(F)(F)F)cc1.
What is the InChIKey of [(2R,3R)-1-methyl-2-[4-(trifluoromethyl)phenyl]piperidin-3-yl]methyl 2-fluorobenzoate?
The InChIKey is WSPOOGDTPZVEJW-FUKCDUGKSA-N. The full InChI is InChI=1S/C21H21F4NO2/c1-26-12-4-5-15(13-28-20(27)17-6-2-3-7-18(17)22)19(26)14-8-10-16(11-9-14)21(23,24)25/h2-3,6-11,15,19H,4-5,12-13H2,1H3/t15-,19?/m0/s1.
What are the key properties of [(2R,3R)-1-methyl-2-[4-(trifluoromethyl)phenyl]piperidin-3-yl]methyl 2-fluorobenzoate?
[(2R,3R)-1-methyl-2-[4-(trifluoromethyl)phenyl]piperidin-3-yl]methyl 2-fluorobenzoate has a molecular weight of 395.40 g/mol, XLogP of 5.08, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R,3R)-1-methyl-2-[4-(trifluoromethyl)phenyl]piperidin-3-yl]methyl 2-fluorobenzoate is sourced from PubChem (CID 96504413), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).