C22H24N4O — CID 96509471
(2R)-1-benzyl-N-[[4-(imidazol-1-ylmethyl)phenyl]methyl]azetidine-2-carboxamide (PubChem CID 96509471) has the molecular formula C22H24N4O and a molecular weight of 360.46 g/mol. Its IUPAC name is (2R)-1-benzyl-N-[[4-(imidazol-1-ylmethyl)phenyl]methyl]azetidine-2-carboxamide.
| Compound Name | (2R)-1-benzyl-N-[[4-(imidazol-1-ylmethyl)phenyl]methyl]azetidine-2-carboxamide |
|---|---|
| PubChem CID | 96509471 |
| Molecular Formula | C22H24N4O |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | (2R)-1-benzyl-N-[[4-(imidazol-1-ylmethyl)phenyl]methyl]azetidine-2-carboxamide |
| SMILES | O=C(NCc1ccc(Cn2ccnc2)cc1)[C@H]1CCN1Cc1ccccc1 |
| InChI | InChI=1S/C22H24N4O/c27-22(21-10-12-26(21)16-19-4-2-1-3-5-19)24-14-18-6-8-20(9-7-18)15-25-13-11-23-17-25/h1-9,11,13,17,21H,10,12,14-16H2,(H,24,27)/t21-/m1/s1 |
| InChIKey | RWAFZMZDUQOFTI-OAQYLSRUSA-N |
| XLogP | 2.82 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |