C17H18F3N5 — CID 96511992
4-[(1S)-1-[[(6S)-6-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl]methylamino]ethyl]benzonitrile (PubChem CID 96511992) has the molecular formula C17H18F3N5 and a molecular weight of 349.36 g/mol. Its IUPAC name is 4-[(1S)-1-[[(6S)-6-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl]methylamino]ethyl]benzonitrile.
| Compound Name | 4-[(1S)-1-[[(6S)-6-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl]methylamino]ethyl]benzonitrile |
|---|---|
| PubChem CID | 96511992 |
| Molecular Formula | C17H18F3N5 |
| Molecular Weight | 349.36 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | 4-[(1S)-1-[[(6S)-6-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl]methylamino]ethyl]benzonitrile |
| SMILES | C[C@H](NCc1nnc2n1C[C@@H](C(F)(F)F)CC2)c1ccc(C#N)cc1 |
| InChI | InChI=1S/C17H18F3N5/c1-11(13-4-2-12(8-21)3-5-13)22-9-16-24-23-15-7-6-14(10-25(15)16)17(18,19)20/h2-5,11,14,22H,6-7,9-10H2,1H3/t11-,14-/m0/s1 |
| InChIKey | JJRLANDXWXCYHK-FZMZJTMJSA-N |
| XLogP | 3.13 |
| TPSA | 66.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.36 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |