About 6-[(3R,4R)-3-(dimethylamino)-4-methylpyrrolidine-1-carbonyl]-2-propylpyridazin-3-one
6-[(3R,4R)-3-(dimethylamino)-4-methylpyrrolidine-1-carbonyl]-2-propylpyridazin-3-one (PubChem CID 96513014) has the molecular formula C15H24N4O2
and a molecular weight of 292.38 g/mol. Its IUPAC name is 6-[(3R,4R)-3-(dimethylamino)-4-methylpyrrolidine-1-carbonyl]-2-propylpyridazin-3-one.
Molecular Properties
| Compound Name | 6-[(3R,4R)-3-(dimethylamino)-4-methylpyrrolidine-1-carbonyl]-2-propylpyridazin-3-one |
| PubChem CID | 96513014 |
| Molecular Formula | C15H24N4O2 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.19 |
| IUPAC Name | 6-[(3R,4R)-3-(dimethylamino)-4-methylpyrrolidine-1-carbonyl]-2-propylpyridazin-3-one |
| SMILES | CCCn1nc(C(=O)N2C[C@@H](C)[C@@H](N(C)C)C2)ccc1=O |
| InChI | InChI=1S/C15H24N4O2/c1-5-8-19-14(20)7-6-12(16-19)15(21)18-9-11(2)13(10-18)17(3)4/h6-7,11,13H,5,8-10H2,1-4H3/t11-,13+/m1/s1 |
| InChIKey | YMOUOLAQYZTLKQ-YPMHNXCESA-N |
| XLogP | 0.68 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-[(3R,4R)-3-(dimethylamino)-4-methylpyrrolidine-1-carbonyl]-2-propylpyridazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(3R,4R)-3-(dimethylamino)-4-methylpyrrolidine-1-carbonyl]-2-propylpyridazin-3-one?
The IUPAC name of 6-[(3R,4R)-3-(dimethylamino)-4-methylpyrrolidine-1-carbonyl]-2-propylpyridazin-3-one (CID 96513014) is 6-[(3R,4R)-3-(dimethylamino)-4-methylpyrrolidine-1-carbonyl]-2-propylpyridazin-3-one.
What is the SMILES notation for 6-[(3R,4R)-3-(dimethylamino)-4-methylpyrrolidine-1-carbonyl]-2-propylpyridazin-3-one?
The canonical SMILES for 6-[(3R,4R)-3-(dimethylamino)-4-methylpyrrolidine-1-carbonyl]-2-propylpyridazin-3-one is CCCn1nc(C(=O)N2C[C@@H](C)[C@@H](N(C)C)C2)ccc1=O.
What is the InChIKey of 6-[(3R,4R)-3-(dimethylamino)-4-methylpyrrolidine-1-carbonyl]-2-propylpyridazin-3-one?
The InChIKey is YMOUOLAQYZTLKQ-YPMHNXCESA-N. The full InChI is InChI=1S/C15H24N4O2/c1-5-8-19-14(20)7-6-12(16-19)15(21)18-9-11(2)13(10-18)17(3)4/h6-7,11,13H,5,8-10H2,1-4H3/t11-,13+/m1/s1.
What are the key properties of 6-[(3R,4R)-3-(dimethylamino)-4-methylpyrrolidine-1-carbonyl]-2-propylpyridazin-3-one?
6-[(3R,4R)-3-(dimethylamino)-4-methylpyrrolidine-1-carbonyl]-2-propylpyridazin-3-one has a molecular weight of 292.38 g/mol, XLogP of 0.68, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(3R,4R)-3-(dimethylamino)-4-methylpyrrolidine-1-carbonyl]-2-propylpyridazin-3-one is sourced from PubChem (CID 96513014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).