About 2-butyl-6-[(3S,4S)-3-(dimethylamino)-4-methylpyrrolidine-1-carbonyl]pyridazin-3-one
2-butyl-6-[(3S,4S)-3-(dimethylamino)-4-methylpyrrolidine-1-carbonyl]pyridazin-3-one (PubChem CID 96513051) has the molecular formula C16H26N4O2
and a molecular weight of 306.41 g/mol. Its IUPAC name is 2-butyl-6-[(3S,4S)-3-(dimethylamino)-4-methylpyrrolidine-1-carbonyl]pyridazin-3-one.
Molecular Properties
| Compound Name | 2-butyl-6-[(3S,4S)-3-(dimethylamino)-4-methylpyrrolidine-1-carbonyl]pyridazin-3-one |
| PubChem CID | 96513051 |
| Molecular Formula | C16H26N4O2 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.21 |
| IUPAC Name | 2-butyl-6-[(3S,4S)-3-(dimethylamino)-4-methylpyrrolidine-1-carbonyl]pyridazin-3-one |
| SMILES | CCCCn1nc(C(=O)N2C[C@@H](N(C)C)[C@@H](C)C2)ccc1=O |
| InChI | InChI=1S/C16H26N4O2/c1-5-6-9-20-15(21)8-7-13(17-20)16(22)19-10-12(2)14(11-19)18(3)4/h7-8,12,14H,5-6,9-11H2,1-4H3/t12-,14+/m0/s1 |
| InChIKey | JXYQOZFVYIBLSG-GXTWGEPZSA-N |
| XLogP | 1.07 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-butyl-6-[(3S,4S)-3-(dimethylamino)-4-methylpyrrolidine-1-carbonyl]pyridazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butyl-6-[(3S,4S)-3-(dimethylamino)-4-methylpyrrolidine-1-carbonyl]pyridazin-3-one?
The IUPAC name of 2-butyl-6-[(3S,4S)-3-(dimethylamino)-4-methylpyrrolidine-1-carbonyl]pyridazin-3-one (CID 96513051) is 2-butyl-6-[(3S,4S)-3-(dimethylamino)-4-methylpyrrolidine-1-carbonyl]pyridazin-3-one.
What is the SMILES notation for 2-butyl-6-[(3S,4S)-3-(dimethylamino)-4-methylpyrrolidine-1-carbonyl]pyridazin-3-one?
The canonical SMILES for 2-butyl-6-[(3S,4S)-3-(dimethylamino)-4-methylpyrrolidine-1-carbonyl]pyridazin-3-one is CCCCn1nc(C(=O)N2C[C@@H](N(C)C)[C@@H](C)C2)ccc1=O.
What is the InChIKey of 2-butyl-6-[(3S,4S)-3-(dimethylamino)-4-methylpyrrolidine-1-carbonyl]pyridazin-3-one?
The InChIKey is JXYQOZFVYIBLSG-GXTWGEPZSA-N. The full InChI is InChI=1S/C16H26N4O2/c1-5-6-9-20-15(21)8-7-13(17-20)16(22)19-10-12(2)14(11-19)18(3)4/h7-8,12,14H,5-6,9-11H2,1-4H3/t12-,14+/m0/s1.
What are the key properties of 2-butyl-6-[(3S,4S)-3-(dimethylamino)-4-methylpyrrolidine-1-carbonyl]pyridazin-3-one?
2-butyl-6-[(3S,4S)-3-(dimethylamino)-4-methylpyrrolidine-1-carbonyl]pyridazin-3-one has a molecular weight of 306.41 g/mol, XLogP of 1.07, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butyl-6-[(3S,4S)-3-(dimethylamino)-4-methylpyrrolidine-1-carbonyl]pyridazin-3-one is sourced from PubChem (CID 96513051), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).