C16H16N2O5S — CID 96515513
5-methoxy-2-nitro-N-[2-[(S)-phenylsulfinyl]ethyl]benzamide (PubChem CID 96515513) has the molecular formula C16H16N2O5S and a molecular weight of 348.38 g/mol. Its IUPAC name is 5-methoxy-2-nitro-N-[2-[(S)-phenylsulfinyl]ethyl]benzamide.
| Compound Name | 5-methoxy-2-nitro-N-[2-[(S)-phenylsulfinyl]ethyl]benzamide |
|---|---|
| PubChem CID | 96515513 |
| Molecular Formula | C16H16N2O5S |
| Molecular Weight | 348.38 g/mol |
| Exact Mass | 348.08 |
| IUPAC Name | 5-methoxy-2-nitro-N-[2-[(S)-phenylsulfinyl]ethyl]benzamide |
| SMILES | COc1ccc([N+](=O)[O-])c(C(=O)NCC[S@](=O)c2ccccc2)c1 |
| InChI | InChI=1S/C16H16N2O5S/c1-23-12-7-8-15(18(20)21)14(11-12)16(19)17-9-10-24(22)13-5-3-2-4-6-13/h2-8,11H,9-10H2,1H3,(H,17,19)/t24-/m0/s1 |
| InChIKey | NDKKVXVUPSANCO-DEOSSOPVSA-N |
| XLogP | 2.14 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.38 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|