About 1-[(1S)-1-(1,3-dimethylpyrazol-4-yl)ethyl]-3-[(2S)-3-ethyl-2-hydroxypentyl]urea
1-[(1S)-1-(1,3-dimethylpyrazol-4-yl)ethyl]-3-[(2S)-3-ethyl-2-hydroxypentyl]urea (PubChem CID 96516525) has the molecular formula C15H28N4O2
and a molecular weight of 296.41 g/mol. Its IUPAC name is 1-[(1S)-1-(1,3-dimethylpyrazol-4-yl)ethyl]-3-[(2S)-3-ethyl-2-hydroxypentyl]urea.
Molecular Properties
| Compound Name | 1-[(1S)-1-(1,3-dimethylpyrazol-4-yl)ethyl]-3-[(2S)-3-ethyl-2-hydroxypentyl]urea |
| PubChem CID | 96516525 |
| Molecular Formula | C15H28N4O2 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.22 |
| IUPAC Name | 1-[(1S)-1-(1,3-dimethylpyrazol-4-yl)ethyl]-3-[(2S)-3-ethyl-2-hydroxypentyl]urea |
| SMILES | CCC(CC)[C@H](O)CNC(=O)N[C@@H](C)c1cn(C)nc1C |
| InChI | InChI=1S/C15H28N4O2/c1-6-12(7-2)14(20)8-16-15(21)17-10(3)13-9-19(5)18-11(13)4/h9-10,12,14,20H,6-8H2,1-5H3,(H2,16,17,21)/t10-,14+/m0/s1 |
| InChIKey | DSCXLMVOOULJCL-IINYFYTJSA-N |
| XLogP | 1.89 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[(1S)-1-(1,3-dimethylpyrazol-4-yl)ethyl]-3-[(2S)-3-ethyl-2-hydroxypentyl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1S)-1-(1,3-dimethylpyrazol-4-yl)ethyl]-3-[(2S)-3-ethyl-2-hydroxypentyl]urea?
The IUPAC name of 1-[(1S)-1-(1,3-dimethylpyrazol-4-yl)ethyl]-3-[(2S)-3-ethyl-2-hydroxypentyl]urea (CID 96516525) is 1-[(1S)-1-(1,3-dimethylpyrazol-4-yl)ethyl]-3-[(2S)-3-ethyl-2-hydroxypentyl]urea.
What is the SMILES notation for 1-[(1S)-1-(1,3-dimethylpyrazol-4-yl)ethyl]-3-[(2S)-3-ethyl-2-hydroxypentyl]urea?
The canonical SMILES for 1-[(1S)-1-(1,3-dimethylpyrazol-4-yl)ethyl]-3-[(2S)-3-ethyl-2-hydroxypentyl]urea is CCC(CC)[C@H](O)CNC(=O)N[C@@H](C)c1cn(C)nc1C.
What is the InChIKey of 1-[(1S)-1-(1,3-dimethylpyrazol-4-yl)ethyl]-3-[(2S)-3-ethyl-2-hydroxypentyl]urea?
The InChIKey is DSCXLMVOOULJCL-IINYFYTJSA-N. The full InChI is InChI=1S/C15H28N4O2/c1-6-12(7-2)14(20)8-16-15(21)17-10(3)13-9-19(5)18-11(13)4/h9-10,12,14,20H,6-8H2,1-5H3,(H2,16,17,21)/t10-,14+/m0/s1.
What are the key properties of 1-[(1S)-1-(1,3-dimethylpyrazol-4-yl)ethyl]-3-[(2S)-3-ethyl-2-hydroxypentyl]urea?
1-[(1S)-1-(1,3-dimethylpyrazol-4-yl)ethyl]-3-[(2S)-3-ethyl-2-hydroxypentyl]urea has a molecular weight of 296.41 g/mol, XLogP of 1.89, 7 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1S)-1-(1,3-dimethylpyrazol-4-yl)ethyl]-3-[(2S)-3-ethyl-2-hydroxypentyl]urea is sourced from PubChem (CID 96516525), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).