C17H26N4O3 — CID 96516600
tert-butyl (3R)-3-[[(1S)-1-pyridin-4-ylethyl]carbamoylamino]pyrrolidine-1-carboxylate (PubChem CID 96516600) has the molecular formula C17H26N4O3 and a molecular weight of 334.42 g/mol. Its IUPAC name is tert-butyl (3R)-3-[[(1S)-1-pyridin-4-ylethyl]carbamoylamino]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3R)-3-[[(1S)-1-pyridin-4-ylethyl]carbamoylamino]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 96516600 |
| Molecular Formula | C17H26N4O3 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.20 |
| IUPAC Name | tert-butyl (3R)-3-[[(1S)-1-pyridin-4-ylethyl]carbamoylamino]pyrrolidine-1-carboxylate |
| SMILES | C[C@H](NC(=O)N[C@@H]1CCN(C(=O)OC(C)(C)C)C1)c1ccncc1 |
| InChI | InChI=1S/C17H26N4O3/c1-12(13-5-8-18-9-6-13)19-15(22)20-14-7-10-21(11-14)16(23)24-17(2,3)4/h5-6,8-9,12,14H,7,10-11H2,1-4H3,(H2,19,20,22)/t12-,14+/m0/s1 |
| InChIKey | GBTOBKUQTGYPOV-GXTWGEPZSA-N |
| XLogP | 2.45 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |