C19H24N4O — CID 96516852
(2R)-2-(3,4-dihydro-1H-isoquinolin-2-yl)-N-[(6R)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-yl]propanamide (PubChem CID 96516852) has the molecular formula C19H24N4O and a molecular weight of 324.43 g/mol. Its IUPAC name is (2R)-2-(3,4-dihydro-1H-isoquinolin-2-yl)-N-[(6R)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-yl]propanamide.
| Compound Name | (2R)-2-(3,4-dihydro-1H-isoquinolin-2-yl)-N-[(6R)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-yl]propanamide |
|---|---|
| PubChem CID | 96516852 |
| Molecular Formula | C19H24N4O |
| Molecular Weight | 324.43 g/mol |
| Exact Mass | 324.20 |
| IUPAC Name | (2R)-2-(3,4-dihydro-1H-isoquinolin-2-yl)-N-[(6R)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-yl]propanamide |
| SMILES | C[C@H](C(=O)N[C@@H]1CCc2nccn2C1)N1CCc2ccccc2C1 |
| InChI | InChI=1S/C19H24N4O/c1-14(22-10-8-15-4-2-3-5-16(15)12-22)19(24)21-17-6-7-18-20-9-11-23(18)13-17/h2-5,9,11,14,17H,6-8,10,12-13H2,1H3,(H,21,24)/t14-,17-/m1/s1 |
| InChIKey | RGZBJANEXACSTR-RHSMWYFYSA-N |
| XLogP | 1.76 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.43 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |