C17H23BrN4O2S — CID 96516886
4-[(S)-(4-bromophenyl)sulfinyl]-N-[1-[2-(dimethylamino)ethyl]pyrazol-4-yl]butanamide (PubChem CID 96516886) has the molecular formula C17H23BrN4O2S and a molecular weight of 427.37 g/mol. Its IUPAC name is 4-[(S)-(4-bromophenyl)sulfinyl]-N-[1-[2-(dimethylamino)ethyl]pyrazol-4-yl]butanamide.
| Compound Name | 4-[(S)-(4-bromophenyl)sulfinyl]-N-[1-[2-(dimethylamino)ethyl]pyrazol-4-yl]butanamide |
|---|---|
| PubChem CID | 96516886 |
| Molecular Formula | C17H23BrN4O2S |
| Molecular Weight | 427.37 g/mol |
| Exact Mass | 426.07 |
| IUPAC Name | 4-[(S)-(4-bromophenyl)sulfinyl]-N-[1-[2-(dimethylamino)ethyl]pyrazol-4-yl]butanamide |
| SMILES | CN(C)CCn1cc(NC(=O)CCC[S@](=O)c2ccc(Br)cc2)cn1 |
| InChI | InChI=1S/C17H23BrN4O2S/c1-21(2)9-10-22-13-15(12-19-22)20-17(23)4-3-11-25(24)16-7-5-14(18)6-8-16/h5-8,12-13H,3-4,9-11H2,1-2H3,(H,20,23)/t25-/m0/s1 |
| InChIKey | NPSZEOSHMLATFR-VWLOTQADSA-N |
| XLogP | 2.73 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.37 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |