About 1-[[(1R,2S)-2-hydroxycyclopentyl]methyl]-3-[1-(2-methoxyethyl)indol-5-yl]urea
1-[[(1R,2S)-2-hydroxycyclopentyl]methyl]-3-[1-(2-methoxyethyl)indol-5-yl]urea (PubChem CID 96518060) has the molecular formula C18H25N3O3
and a molecular weight of 331.42 g/mol. Its IUPAC name is 1-[[(1R,2S)-2-hydroxycyclopentyl]methyl]-3-[1-(2-methoxyethyl)indol-5-yl]urea.
Molecular Properties
| Compound Name | 1-[[(1R,2S)-2-hydroxycyclopentyl]methyl]-3-[1-(2-methoxyethyl)indol-5-yl]urea |
| PubChem CID | 96518060 |
| Molecular Formula | C18H25N3O3 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.19 |
| IUPAC Name | 1-[[(1R,2S)-2-hydroxycyclopentyl]methyl]-3-[1-(2-methoxyethyl)indol-5-yl]urea |
| SMILES | COCCn1ccc2cc(NC(=O)NC[C@H]3CCC[C@@H]3O)ccc21 |
| InChI | InChI=1S/C18H25N3O3/c1-24-10-9-21-8-7-13-11-15(5-6-16(13)21)20-18(23)19-12-14-3-2-4-17(14)22/h5-8,11,14,17,22H,2-4,9-10,12H2,1H3,(H2,19,20,23)/t14-,17+/m1/s1 |
| InChIKey | YIYFZUGEEIKHSG-PBHICJAKSA-N |
| XLogP | 2.57 |
| TPSA | 75.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[[(1R,2S)-2-hydroxycyclopentyl]methyl]-3-[1-(2-methoxyethyl)indol-5-yl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[(1R,2S)-2-hydroxycyclopentyl]methyl]-3-[1-(2-methoxyethyl)indol-5-yl]urea?
The IUPAC name of 1-[[(1R,2S)-2-hydroxycyclopentyl]methyl]-3-[1-(2-methoxyethyl)indol-5-yl]urea (CID 96518060) is 1-[[(1R,2S)-2-hydroxycyclopentyl]methyl]-3-[1-(2-methoxyethyl)indol-5-yl]urea.
What is the SMILES notation for 1-[[(1R,2S)-2-hydroxycyclopentyl]methyl]-3-[1-(2-methoxyethyl)indol-5-yl]urea?
The canonical SMILES for 1-[[(1R,2S)-2-hydroxycyclopentyl]methyl]-3-[1-(2-methoxyethyl)indol-5-yl]urea is COCCn1ccc2cc(NC(=O)NC[C@H]3CCC[C@@H]3O)ccc21.
What is the InChIKey of 1-[[(1R,2S)-2-hydroxycyclopentyl]methyl]-3-[1-(2-methoxyethyl)indol-5-yl]urea?
The InChIKey is YIYFZUGEEIKHSG-PBHICJAKSA-N. The full InChI is InChI=1S/C18H25N3O3/c1-24-10-9-21-8-7-13-11-15(5-6-16(13)21)20-18(23)19-12-14-3-2-4-17(14)22/h5-8,11,14,17,22H,2-4,9-10,12H2,1H3,(H2,19,20,23)/t14-,17+/m1/s1.
What are the key properties of 1-[[(1R,2S)-2-hydroxycyclopentyl]methyl]-3-[1-(2-methoxyethyl)indol-5-yl]urea?
1-[[(1R,2S)-2-hydroxycyclopentyl]methyl]-3-[1-(2-methoxyethyl)indol-5-yl]urea has a molecular weight of 331.42 g/mol, XLogP of 2.57, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[(1R,2S)-2-hydroxycyclopentyl]methyl]-3-[1-(2-methoxyethyl)indol-5-yl]urea is sourced from PubChem (CID 96518060), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).